C18H28N4O2 — CID 66966694
2-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)-N-(3-piperidin-1-ylpropyl)acetamide (PubChem CID 66966694) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 2-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)-N-(3-piperidin-1-ylpropyl)acetamide.
| Compound Name | 2-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)-N-(3-piperidin-1-ylpropyl)acetamide |
|---|---|
| PubChem CID | 66966694 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 2-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)-N-(3-piperidin-1-ylpropyl)acetamide |
| SMILES | O=C(Cc1n[nH]c(=O)c2c1CCCC2)NCCCN1CCCCC1 |
| InChI | InChI=1S/C18H28N4O2/c23-17(19-9-6-12-22-10-4-1-5-11-22)13-16-14-7-2-3-8-15(14)18(24)21-20-16/h1-13H2,(H,19,23)(H,21,24) |
| InChIKey | DLGLRPJUMZXPNQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|