C15H24N4O2 — CID 66966719
2-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)-N-[2-(propylamino)ethyl]acetamide (PubChem CID 66966719) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 2-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)-N-[2-(propylamino)ethyl]acetamide.
| Compound Name | 2-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)-N-[2-(propylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 66966719 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-(4-oxo-5,6,7,8-tetrahydro-3H-phthalazin-1-yl)-N-[2-(propylamino)ethyl]acetamide |
| SMILES | CCCNCCNC(=O)Cc1n[nH]c(=O)c2c1CCCC2 |
| InChI | InChI=1S/C15H24N4O2/c1-2-7-16-8-9-17-14(20)10-13-11-5-3-4-6-12(11)15(21)19-18-13/h16H,2-10H2,1H3,(H,17,20)(H,19,21) |
| InChIKey | YAYIFRJUKJBXIY-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|