C19H23NO3S — CID 66967843
tert-butyl (2S)-2-(1-benzothiophene-2-carbonyl)piperidine-1-carboxylate (PubChem CID 66967843) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is tert-butyl (2S)-2-(1-benzothiophene-2-carbonyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(1-benzothiophene-2-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66967843 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | tert-butyl (2S)-2-(1-benzothiophene-2-carbonyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC[C@H]1C(=O)c1cc2ccccc2s1 |
| InChI | InChI=1S/C19H23NO3S/c1-19(2,3)23-18(22)20-11-7-6-9-14(20)17(21)16-12-13-8-4-5-10-15(13)24-16/h4-5,8,10,12,14H,6-7,9,11H2,1-3H3/t14-/m0/s1 |
| InChIKey | DTQFHRCWELRJEX-AWEZNQCLSA-N |
| XLogP | 4.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |