About 6-amino-5-hydroxycyclohexa-2,4-dien-1-one
6-amino-5-hydroxycyclohexa-2,4-dien-1-one (PubChem CID 66968028) has the molecular formula C6H7NO2
and a molecular weight of 125.13 g/mol. Its IUPAC name is 6-amino-5-hydroxycyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 6-amino-5-hydroxycyclohexa-2,4-dien-1-one |
| PubChem CID | 66968028 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | 6-amino-5-hydroxycyclohexa-2,4-dien-1-one |
| SMILES | NC1C(=O)C=CC=C1O |
| InChI | InChI=1S/C6H7NO2/c7-6-4(8)2-1-3-5(6)9/h1-3,6,8H,7H2 |
| InChIKey | PNFVHDSVTMMYFM-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-5-hydroxycyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-hydroxycyclohexa-2,4-dien-1-one?
The IUPAC name of 6-amino-5-hydroxycyclohexa-2,4-dien-1-one (CID 66968028) is 6-amino-5-hydroxycyclohexa-2,4-dien-1-one.
What is the SMILES notation for 6-amino-5-hydroxycyclohexa-2,4-dien-1-one?
The canonical SMILES for 6-amino-5-hydroxycyclohexa-2,4-dien-1-one is NC1C(=O)C=CC=C1O.
What is the InChIKey of 6-amino-5-hydroxycyclohexa-2,4-dien-1-one?
The InChIKey is PNFVHDSVTMMYFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2/c7-6-4(8)2-1-3-5(6)9/h1-3,6,8H,7H2.
What are the key properties of 6-amino-5-hydroxycyclohexa-2,4-dien-1-one?
6-amino-5-hydroxycyclohexa-2,4-dien-1-one has a molecular weight of 125.13 g/mol, XLogP of -0.11, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-hydroxycyclohexa-2,4-dien-1-one is sourced from PubChem (CID 66968028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).