C24H25F4N2O3+ — CID 66969085
1,1,1-trifluoro-4-(3-fluoro-2-methoxy-4-methylphenyl)-3-methyl-2-[(1-oxo-2H-quinolin-1-ium-5-yl)iminomethyl]pentan-2-ol (PubChem CID 66969085) has the molecular formula C24H25F4N2O3+ and a molecular weight of 465.47 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(3-fluoro-2-methoxy-4-methylphenyl)-3-methyl-2-[(1-oxo-2H-quinolin-1-ium-5-yl)iminomethyl]pentan-2-ol.
| Compound Name | 1,1,1-trifluoro-4-(3-fluoro-2-methoxy-4-methylphenyl)-3-methyl-2-[(1-oxo-2H-quinolin-1-ium-5-yl)iminomethyl]pentan-2-ol |
|---|---|
| PubChem CID | 66969085 |
| Molecular Formula | C24H25F4N2O3+ |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 1,1,1-trifluoro-4-(3-fluoro-2-methoxy-4-methylphenyl)-3-methyl-2-[(1-oxo-2H-quinolin-1-ium-5-yl)iminomethyl]pentan-2-ol |
| SMILES | COc1c(C(C)C(C)C(O)(/C=N/c2cccc3c2C=CC[N+]3=O)C(F)(F)F)ccc(C)c1F |
| InChI | InChI=1S/C24H25F4N2O3/c1-14-10-11-17(22(33-4)21(14)25)15(2)16(3)23(31,24(26,27)28)13-29-19-8-5-9-20-18(19)7-6-12-30(20)32/h5-11,13,15-16,31H,12H2,1-4H3/q+1/b29-13+ |
| InChIKey | AXOWBPAEHCMMBE-VFLNYLIXSA-N |
| XLogP | 6.02 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|