C13H23ClO4 — CID 66969113
2-[(4R,6S)-4-tert-butyl-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid (PubChem CID 66969113) has the molecular formula C13H23ClO4 and a molecular weight of 278.78 g/mol. Its IUPAC name is 2-[(4R,6S)-4-tert-butyl-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid.
| Compound Name | 2-[(4R,6S)-4-tert-butyl-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 66969113 |
| Molecular Formula | C13H23ClO4 |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-[(4R,6S)-4-tert-butyl-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetic acid |
| SMILES | CC1(C)O[C@H](CCl)C[C@@](CC(=O)O)(C(C)(C)C)O1 |
| InChI | InChI=1S/C13H23ClO4/c1-11(2,3)13(7-10(15)16)6-9(8-14)17-12(4,5)18-13/h9H,6-8H2,1-5H3,(H,15,16)/t9-,13+/m0/s1 |
| InChIKey | VMSLXHLLAKIAID-TVQRCGJNSA-N |
| XLogP | 3.03 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|