About 2-methoxy-2-phenyl-1-(1,2,4-triazol-1-yl)ethanone
2-methoxy-2-phenyl-1-(1,2,4-triazol-1-yl)ethanone (PubChem CID 66969194) has the molecular formula C11H11N3O2
and a molecular weight of 217.23 g/mol. Its IUPAC name is 2-methoxy-2-phenyl-1-(1,2,4-triazol-1-yl)ethanone.
Molecular Properties
| Compound Name | 2-methoxy-2-phenyl-1-(1,2,4-triazol-1-yl)ethanone |
| PubChem CID | 66969194 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 2-methoxy-2-phenyl-1-(1,2,4-triazol-1-yl)ethanone |
| SMILES | COC(C(=O)n1cncn1)c1ccccc1 |
| InChI | InChI=1S/C11H11N3O2/c1-16-10(9-5-3-2-4-6-9)11(15)14-8-12-7-13-14/h2-8,10H,1H3 |
| InChIKey | LPZYDYBLGKDILR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methoxy-2-phenyl-1-(1,2,4-triazol-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-2-phenyl-1-(1,2,4-triazol-1-yl)ethanone?
The IUPAC name of 2-methoxy-2-phenyl-1-(1,2,4-triazol-1-yl)ethanone (CID 66969194) is 2-methoxy-2-phenyl-1-(1,2,4-triazol-1-yl)ethanone.
What is the SMILES notation for 2-methoxy-2-phenyl-1-(1,2,4-triazol-1-yl)ethanone?
The canonical SMILES for 2-methoxy-2-phenyl-1-(1,2,4-triazol-1-yl)ethanone is COC(C(=O)n1cncn1)c1ccccc1.
What is the InChIKey of 2-methoxy-2-phenyl-1-(1,2,4-triazol-1-yl)ethanone?
The InChIKey is LPZYDYBLGKDILR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O2/c1-16-10(9-5-3-2-4-6-9)11(15)14-8-12-7-13-14/h2-8,10H,1H3.
What are the key properties of 2-methoxy-2-phenyl-1-(1,2,4-triazol-1-yl)ethanone?
2-methoxy-2-phenyl-1-(1,2,4-triazol-1-yl)ethanone has a molecular weight of 217.23 g/mol, XLogP of 1.31, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-2-phenyl-1-(1,2,4-triazol-1-yl)ethanone is sourced from PubChem (CID 66969194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).