C16H13F3N4O — CID 66969266
4-[1-[4-(1,2,2-trifluoroethoxy)phenyl]-1,2,4-triazol-3-yl]aniline (PubChem CID 66969266) has the molecular formula C16H13F3N4O and a molecular weight of 334.30 g/mol. Its IUPAC name is 4-[1-[4-(1,2,2-trifluoroethoxy)phenyl]-1,2,4-triazol-3-yl]aniline.
| Compound Name | 4-[1-[4-(1,2,2-trifluoroethoxy)phenyl]-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 66969266 |
| Molecular Formula | C16H13F3N4O |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 4-[1-[4-(1,2,2-trifluoroethoxy)phenyl]-1,2,4-triazol-3-yl]aniline |
| SMILES | Nc1ccc(-c2ncn(-c3ccc(OC(F)C(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C16H13F3N4O/c17-14(18)15(19)24-13-7-5-12(6-8-13)23-9-21-16(22-23)10-1-3-11(20)4-2-10/h1-9,14-15H,20H2 |
| InChIKey | VCHAXUKWMQCGQU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|