C21H21ClF3N3O2 — CID 66969369
4-(3-chloro-2-methoxyphenyl)-1,1,1-trifluoro-2-(1H-indazol-5-yliminomethyl)hexan-2-ol (PubChem CID 66969369) has the molecular formula C21H21ClF3N3O2 and a molecular weight of 439.87 g/mol. Its IUPAC name is 4-(3-chloro-2-methoxyphenyl)-1,1,1-trifluoro-2-(1H-indazol-5-yliminomethyl)hexan-2-ol.
| Compound Name | 4-(3-chloro-2-methoxyphenyl)-1,1,1-trifluoro-2-(1H-indazol-5-yliminomethyl)hexan-2-ol |
|---|---|
| PubChem CID | 66969369 |
| Molecular Formula | C21H21ClF3N3O2 |
| Molecular Weight | 439.87 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | 4-(3-chloro-2-methoxyphenyl)-1,1,1-trifluoro-2-(1H-indazol-5-yliminomethyl)hexan-2-ol |
| SMILES | CCC(CC(O)(/C=N/c1ccc2[nH]ncc2c1)C(F)(F)F)c1cccc(Cl)c1OC |
| InChI | InChI=1S/C21H21ClF3N3O2/c1-3-13(16-5-4-6-17(22)19(16)30-2)10-20(29,21(23,24)25)12-26-15-7-8-18-14(9-15)11-27-28-18/h4-9,11-13,29H,3,10H2,1-2H3,(H,27,28)/b26-12+ |
| InChIKey | UEXJYIKIALKXED-RPPGKUMJSA-N |
| XLogP | 5.80 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.87 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|