C24H24F4N2O3 — CID 66969485
5-[[(1S,2S,4R)-4-ethyl-2,5-dihydroxy-6,7-dimethyl-2-(trifluoromethyl)-3,4-dihydro-1H-naphthalen-1-yl]amino]-8-fluoro-1H-quinolin-2-one (PubChem CID 66969485) has the molecular formula C24H24F4N2O3 and a molecular weight of 464.46 g/mol. Its IUPAC name is 5-[[(1S,2S,4R)-4-ethyl-2,5-dihydroxy-6,7-dimethyl-2-(trifluoromethyl)-3,4-dihydro-1H-naphthalen-1-yl]amino]-8-fluoro-1H-quinolin-2-one.
| Compound Name | 5-[[(1S,2S,4R)-4-ethyl-2,5-dihydroxy-6,7-dimethyl-2-(trifluoromethyl)-3,4-dihydro-1H-naphthalen-1-yl]amino]-8-fluoro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 66969485 |
| Molecular Formula | C24H24F4N2O3 |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | 5-[[(1S,2S,4R)-4-ethyl-2,5-dihydroxy-6,7-dimethyl-2-(trifluoromethyl)-3,4-dihydro-1H-naphthalen-1-yl]amino]-8-fluoro-1H-quinolin-2-one |
| SMILES | CC[C@@H]1C[C@@](O)(C(F)(F)F)[C@@H](Nc2ccc(F)c3[nH]c(=O)ccc23)c2cc(C)c(C)c(O)c21 |
| InChI | InChI=1S/C24H24F4N2O3/c1-4-13-10-23(33,24(26,27)28)22(15-9-11(2)12(3)21(32)19(13)15)29-17-7-6-16(25)20-14(17)5-8-18(31)30-20/h5-9,13,22,29,32-33H,4,10H2,1-3H3,(H,30,31)/t13-,22+,23+/m1/s1 |
| InChIKey | BTQTWNLXIWMUEW-KNWAOAHBSA-N |
| XLogP | 5.33 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |