C24H23N3O2 — CID 66970167
[3-(benzotriazol-2-yl)-2-hydroxy-5-pentylphenyl]-phenylmethanone (PubChem CID 66970167) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is [3-(benzotriazol-2-yl)-2-hydroxy-5-pentylphenyl]-phenylmethanone.
| Compound Name | [3-(benzotriazol-2-yl)-2-hydroxy-5-pentylphenyl]-phenylmethanone |
|---|---|
| PubChem CID | 66970167 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | [3-(benzotriazol-2-yl)-2-hydroxy-5-pentylphenyl]-phenylmethanone |
| SMILES | CCCCCc1cc(C(=O)c2ccccc2)c(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C24H23N3O2/c1-2-3-5-10-17-15-19(23(28)18-11-6-4-7-12-18)24(29)22(16-17)27-25-20-13-8-9-14-21(20)26-27/h4,6-9,11-16,29H,2-3,5,10H2,1H3 |
| InChIKey | ZPFJDAFNGHLHPE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|