C19H16F2N6O3 — CID 66970617
2-N-(2-amino-5-fluorophenyl)-4-N-[(4R)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]-5-nitropyrimidine-2,4-diamine (PubChem CID 66970617) has the molecular formula C19H16F2N6O3 and a molecular weight of 414.37 g/mol. Its IUPAC name is 2-N-(2-amino-5-fluorophenyl)-4-N-[(4R)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-amino-5-fluorophenyl)-4-N-[(4R)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 66970617 |
| Molecular Formula | C19H16F2N6O3 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 2-N-(2-amino-5-fluorophenyl)-4-N-[(4R)-8-fluoro-3,4-dihydro-2H-chromen-4-yl]-5-nitropyrimidine-2,4-diamine |
| SMILES | Nc1ccc(F)cc1Nc1ncc([N+](=O)[O-])c(N[C@@H]2CCOc3c(F)cccc32)n1 |
| InChI | InChI=1S/C19H16F2N6O3/c20-10-4-5-13(22)15(8-10)25-19-23-9-16(27(28)29)18(26-19)24-14-6-7-30-17-11(14)2-1-3-12(17)21/h1-5,8-9,14H,6-7,22H2,(H2,23,24,25,26)/t14-/m1/s1 |
| InChIKey | NMESGPSYGVPLTA-CQSZACIVSA-N |
| XLogP | 3.92 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|