C27H31NO — CID 66970923
1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-[2-methoxy-5-(2-phenylethynyl)phenyl]piperidine (PubChem CID 66970923) has the molecular formula C27H31NO and a molecular weight of 385.55 g/mol. Its IUPAC name is 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-[2-methoxy-5-(2-phenylethynyl)phenyl]piperidine.
| Compound Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-[2-methoxy-5-(2-phenylethynyl)phenyl]piperidine |
|---|---|
| PubChem CID | 66970923 |
| Molecular Formula | C27H31NO |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-4-[2-methoxy-5-(2-phenylethynyl)phenyl]piperidine |
| SMILES | COc1ccc(C#Cc2ccccc2)cc1C1CCN([C@@H]2C[C@H]3CC[C@H]2C3)CC1 |
| InChI | InChI=1S/C27H31NO/c1-29-27-12-10-21(8-7-20-5-3-2-4-6-20)18-25(27)23-13-15-28(16-14-23)26-19-22-9-11-24(26)17-22/h2-6,10,12,18,22-24,26H,9,11,13-17,19H2,1H3/t22-,24-,26+/m0/s1 |
| InChIKey | RZIMIMDUQVTWSL-LLZJGCNPSA-N |
| XLogP | 5.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|