About 1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanone
1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanone (PubChem CID 66971106) has the molecular formula C12H12O3
and a molecular weight of 204.22 g/mol. Its IUPAC name is 1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanone.
Molecular Properties
| Compound Name | 1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanone |
| PubChem CID | 66971106 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanone |
| SMILES | CC(=O)C1=COC=C(C2=CC=CCC2)O1 |
| InChI | InChI=1S/C12H12O3/c1-9(13)11-7-14-8-12(15-11)10-5-3-2-4-6-10/h2-3,5,7-8H,4,6H2,1H3 |
| InChIKey | BZVLECHSHXWDFM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanone?
The IUPAC name of 1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanone (CID 66971106) is 1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanone.
What is the SMILES notation for 1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanone?
The canonical SMILES for 1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanone is CC(=O)C1=COC=C(C2=CC=CCC2)O1.
What is the InChIKey of 1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanone?
The InChIKey is BZVLECHSHXWDFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O3/c1-9(13)11-7-14-8-12(15-11)10-5-3-2-4-6-10/h2-3,5,7-8H,4,6H2,1H3.
What are the key properties of 1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanone?
1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanone has a molecular weight of 204.22 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)ethanone is sourced from PubChem (CID 66971106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).