About tert-butyl (2S,4S)-4-amino-2-prop-2-enylpyrrolidine-1-carboxylate
tert-butyl (2S,4S)-4-amino-2-prop-2-enylpyrrolidine-1-carboxylate (PubChem CID 66971163) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is tert-butyl (2S,4S)-4-amino-2-prop-2-enylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S,4S)-4-amino-2-prop-2-enylpyrrolidine-1-carboxylate |
| PubChem CID | 66971163 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | tert-butyl (2S,4S)-4-amino-2-prop-2-enylpyrrolidine-1-carboxylate |
| SMILES | C=CC[C@H]1C[C@H](N)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22N2O2/c1-5-6-10-7-9(13)8-14(10)11(15)16-12(2,3)4/h5,9-10H,1,6-8,13H2,2-4H3/t9-,10-/m0/s1 |
| InChIKey | ZJOUDYQODAOVGR-UWVGGRQHSA-N |
| XLogP | 1.90 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S,4S)-4-amino-2-prop-2-enylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S,4S)-4-amino-2-prop-2-enylpyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S,4S)-4-amino-2-prop-2-enylpyrrolidine-1-carboxylate (CID 66971163) is tert-butyl (2S,4S)-4-amino-2-prop-2-enylpyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S,4S)-4-amino-2-prop-2-enylpyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S,4S)-4-amino-2-prop-2-enylpyrrolidine-1-carboxylate is C=CC[C@H]1C[C@H](N)CN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2S,4S)-4-amino-2-prop-2-enylpyrrolidine-1-carboxylate?
The InChIKey is ZJOUDYQODAOVGR-UWVGGRQHSA-N. The full InChI is InChI=1S/C12H22N2O2/c1-5-6-10-7-9(13)8-14(10)11(15)16-12(2,3)4/h5,9-10H,1,6-8,13H2,2-4H3/t9-,10-/m0/s1.
What are the key properties of tert-butyl (2S,4S)-4-amino-2-prop-2-enylpyrrolidine-1-carboxylate?
tert-butyl (2S,4S)-4-amino-2-prop-2-enylpyrrolidine-1-carboxylate has a molecular weight of 226.32 g/mol, XLogP of 1.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S,4S)-4-amino-2-prop-2-enylpyrrolidine-1-carboxylate is sourced from PubChem (CID 66971163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).