C11H19N3 — CID 66971374
1-pentyl-2,3,4,4a-tetrahydropyrrolo[2,3-b]pyrazine (PubChem CID 66971374) has the molecular formula C11H19N3 and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-pentyl-2,3,4,4a-tetrahydropyrrolo[2,3-b]pyrazine.
| Compound Name | 1-pentyl-2,3,4,4a-tetrahydropyrrolo[2,3-b]pyrazine |
|---|---|
| PubChem CID | 66971374 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | 1-pentyl-2,3,4,4a-tetrahydropyrrolo[2,3-b]pyrazine |
| SMILES | CCCCCN1CCNC2N=CC=C21 |
| InChI | InChI=1S/C11H19N3/c1-2-3-4-8-14-9-7-13-11-10(14)5-6-12-11/h5-6,11,13H,2-4,7-9H2,1H3 |
| InChIKey | RQHYQWRBMILLAK-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|