About 1,4-dimethyl-2H-pyridine;hydrochloride
1,4-dimethyl-2H-pyridine;hydrochloride (PubChem CID 66971379) has the molecular formula C7H12ClN
and a molecular weight of 145.63 g/mol. Its IUPAC name is 1,4-dimethyl-2H-pyridine;hydrochloride.
Molecular Properties
| Compound Name | 1,4-dimethyl-2H-pyridine;hydrochloride |
| PubChem CID | 66971379 |
| Molecular Formula | C7H12ClN |
| Molecular Weight | 145.63 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 1,4-dimethyl-2H-pyridine;hydrochloride |
| SMILES | CC1=CCN(C)C=C1.Cl |
| InChI | InChI=1S/C7H11N.ClH/c1-7-3-5-8(2)6-4-7;/h3-5H,6H2,1-2H3;1H |
| InChIKey | MIBBXJUBNAKLDA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.63 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,4-dimethyl-2H-pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-2H-pyridine;hydrochloride?
The IUPAC name of 1,4-dimethyl-2H-pyridine;hydrochloride (CID 66971379) is 1,4-dimethyl-2H-pyridine;hydrochloride.
What is the SMILES notation for 1,4-dimethyl-2H-pyridine;hydrochloride?
The canonical SMILES for 1,4-dimethyl-2H-pyridine;hydrochloride is CC1=CCN(C)C=C1.Cl.
What is the InChIKey of 1,4-dimethyl-2H-pyridine;hydrochloride?
The InChIKey is MIBBXJUBNAKLDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N.ClH/c1-7-3-5-8(2)6-4-7;/h3-5H,6H2,1-2H3;1H.
What are the key properties of 1,4-dimethyl-2H-pyridine;hydrochloride?
1,4-dimethyl-2H-pyridine;hydrochloride has a molecular weight of 145.63 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-2H-pyridine;hydrochloride is sourced from PubChem (CID 66971379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).