C17H17Cl2N7 — CID 66971586
N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;phthalazin-1-ylhydrazine (PubChem CID 66971586) has the molecular formula C17H17Cl2N7 and a molecular weight of 390.28 g/mol. Its IUPAC name is N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;phthalazin-1-ylhydrazine.
| Compound Name | N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;phthalazin-1-ylhydrazine |
|---|---|
| PubChem CID | 66971586 |
| Molecular Formula | C17H17Cl2N7 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | N-(2,6-dichlorophenyl)-4,5-dihydro-1H-imidazol-2-amine;phthalazin-1-ylhydrazine |
| SMILES | Clc1cccc(Cl)c1NC1=NCCN1.NNc1nncc2ccccc12 |
| InChI | InChI=1S/C9H9Cl2N3.C8H8N4/c10-6-2-1-3-7(11)8(6)14-9-12-4-5-13-9;9-11-8-7-4-2-1-3-6(7)5-10-12-8/h1-3H,4-5H2,(H2,12,13,14);1-5H,9H2,(H,11,12) |
| InChIKey | RJESVFNAYKVNFZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 100.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|