About decan-1-amine;3,6-dichloro-2-methoxybenzoic acid
decan-1-amine;3,6-dichloro-2-methoxybenzoic acid (PubChem CID 66971726) has the molecular formula C18H29Cl2NO3
and a molecular weight of 378.34 g/mol. Its IUPAC name is decan-1-amine;3,6-dichloro-2-methoxybenzoic acid.
Molecular Properties
| Compound Name | decan-1-amine;3,6-dichloro-2-methoxybenzoic acid |
| PubChem CID | 66971726 |
| Molecular Formula | C18H29Cl2NO3 |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | decan-1-amine;3,6-dichloro-2-methoxybenzoic acid |
| SMILES | CCCCCCCCCCN.COc1c(Cl)ccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C10H23N.C8H6Cl2O3/c1-2-3-4-5-6-7-8-9-10-11;1-13-7-5(10)3-2-4(9)6(7)8(11)12/h2-11H2,1H3;2-3H,1H3,(H,11,12) |
| InChIKey | VXORFKGXTXXJRG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze decan-1-amine;3,6-dichloro-2-methoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-1-amine;3,6-dichloro-2-methoxybenzoic acid?
The IUPAC name of decan-1-amine;3,6-dichloro-2-methoxybenzoic acid (CID 66971726) is decan-1-amine;3,6-dichloro-2-methoxybenzoic acid.
What is the SMILES notation for decan-1-amine;3,6-dichloro-2-methoxybenzoic acid?
The canonical SMILES for decan-1-amine;3,6-dichloro-2-methoxybenzoic acid is CCCCCCCCCCN.COc1c(Cl)ccc(Cl)c1C(=O)O.
What is the InChIKey of decan-1-amine;3,6-dichloro-2-methoxybenzoic acid?
The InChIKey is VXORFKGXTXXJRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23N.C8H6Cl2O3/c1-2-3-4-5-6-7-8-9-10-11;1-13-7-5(10)3-2-4(9)6(7)8(11)12/h2-11H2,1H3;2-3H,1H3,(H,11,12).
What are the key properties of decan-1-amine;3,6-dichloro-2-methoxybenzoic acid?
decan-1-amine;3,6-dichloro-2-methoxybenzoic acid has a molecular weight of 378.34 g/mol, XLogP of 5.79, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for decan-1-amine;3,6-dichloro-2-methoxybenzoic acid is sourced from PubChem (CID 66971726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).