C10H13N — CID 66971852
1-ethenyl-2,3,3a,4-tetrahydroindole (PubChem CID 66971852) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 1-ethenyl-2,3,3a,4-tetrahydroindole.
| Compound Name | 1-ethenyl-2,3,3a,4-tetrahydroindole |
|---|---|
| PubChem CID | 66971852 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 1-ethenyl-2,3,3a,4-tetrahydroindole |
| SMILES | C=CN1CCC2CC=CC=C21 |
| InChI | InChI=1S/C10H13N/c1-2-11-8-7-9-5-3-4-6-10(9)11/h2-4,6,9H,1,5,7-8H2 |
| InChIKey | RBDKFUPLQQVSSN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |