About benzoic acid;(2,6-dimethyl-4,7-dioxaspiro[2.5]octan-8-yl)methanol
benzoic acid;(2,6-dimethyl-4,7-dioxaspiro[2.5]octan-8-yl)methanol (PubChem CID 66971950) has the molecular formula C23H28O7
and a molecular weight of 416.47 g/mol. Its IUPAC name is benzoic acid;(2,6-dimethyl-4,7-dioxaspiro[2.5]octan-8-yl)methanol.
Molecular Properties
| Compound Name | benzoic acid;(2,6-dimethyl-4,7-dioxaspiro[2.5]octan-8-yl)methanol |
| PubChem CID | 66971950 |
| Molecular Formula | C23H28O7 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | benzoic acid;(2,6-dimethyl-4,7-dioxaspiro[2.5]octan-8-yl)methanol |
| SMILES | CC1COC2(CC2C)C(CO)O1.O=C(O)c1ccccc1.O=C(O)c1ccccc1 |
| InChI | InChI=1S/C9H16O3.2C7H6O2/c1-6-3-9(6)8(4-10)12-7(2)5-11-9;2*8-7(9)6-4-2-1-3-5-6/h6-8,10H,3-5H2,1-2H3;2*1-5H,(H,8,9) |
| InChIKey | FEYNMCMNNMUSPF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzoic acid;(2,6-dimethyl-4,7-dioxaspiro[2.5]octan-8-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;(2,6-dimethyl-4,7-dioxaspiro[2.5]octan-8-yl)methanol?
The IUPAC name of benzoic acid;(2,6-dimethyl-4,7-dioxaspiro[2.5]octan-8-yl)methanol (CID 66971950) is benzoic acid;(2,6-dimethyl-4,7-dioxaspiro[2.5]octan-8-yl)methanol.
What is the SMILES notation for benzoic acid;(2,6-dimethyl-4,7-dioxaspiro[2.5]octan-8-yl)methanol?
The canonical SMILES for benzoic acid;(2,6-dimethyl-4,7-dioxaspiro[2.5]octan-8-yl)methanol is CC1COC2(CC2C)C(CO)O1.O=C(O)c1ccccc1.O=C(O)c1ccccc1.
What is the InChIKey of benzoic acid;(2,6-dimethyl-4,7-dioxaspiro[2.5]octan-8-yl)methanol?
The InChIKey is FEYNMCMNNMUSPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3.2C7H6O2/c1-6-3-9(6)8(4-10)12-7(2)5-11-9;2*8-7(9)6-4-2-1-3-5-6/h6-8,10H,3-5H2,1-2H3;2*1-5H,(H,8,9).
What are the key properties of benzoic acid;(2,6-dimethyl-4,7-dioxaspiro[2.5]octan-8-yl)methanol?
benzoic acid;(2,6-dimethyl-4,7-dioxaspiro[2.5]octan-8-yl)methanol has a molecular weight of 416.47 g/mol, XLogP of 3.33, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;(2,6-dimethyl-4,7-dioxaspiro[2.5]octan-8-yl)methanol is sourced from PubChem (CID 66971950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).