C20H25F4N3O3S — CID 66972279
N-(1-cyanocyclopropyl)-3-pentylsulfonyl-2-[[(1R)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]propanamide (PubChem CID 66972279) has the molecular formula C20H25F4N3O3S and a molecular weight of 463.50 g/mol. Its IUPAC name is N-(1-cyanocyclopropyl)-3-pentylsulfonyl-2-[[(1R)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]propanamide.
| Compound Name | N-(1-cyanocyclopropyl)-3-pentylsulfonyl-2-[[(1R)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 66972279 |
| Molecular Formula | C20H25F4N3O3S |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | N-(1-cyanocyclopropyl)-3-pentylsulfonyl-2-[[(1R)-2,2,2-trifluoro-1-(4-fluorophenyl)ethyl]amino]propanamide |
| SMILES | CCCCCS(=O)(=O)CC(N[C@H](c1ccc(F)cc1)C(F)(F)F)C(=O)NC1(C#N)CC1 |
| InChI | InChI=1S/C20H25F4N3O3S/c1-2-3-4-11-31(29,30)12-16(18(28)27-19(13-25)9-10-19)26-17(20(22,23)24)14-5-7-15(21)8-6-14/h5-8,16-17,26H,2-4,9-12H2,1H3,(H,27,28)/t16?,17-/m1/s1 |
| InChIKey | ITCURACYMHYNIR-ZYMOGRSISA-N |
| XLogP | 3.16 |
| TPSA | 99.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|