C8H12NO2S- — CID 66972788
2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate (PubChem CID 66972788) has the molecular formula C8H12NO2S- and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate.
| Compound Name | 2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate |
|---|---|
| PubChem CID | 66972788 |
| Molecular Formula | C8H12NO2S- |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate |
| SMILES | Cc1ccn(C)c1CCS(=O)[O-] |
| InChI | InChI=1S/C8H13NO2S/c1-7-3-5-9(2)8(7)4-6-12(10)11/h3,5H,4,6H2,1-2H3,(H,10,11)/p-1 |
| InChIKey | WADNDKXSJUQIDS-UHFFFAOYSA-M |
| XLogP | 0.76 |
| TPSA | 45.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|