About 2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate
2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate (PubChem CID 66972788) has the molecular formula C8H12NO2S-
and a molecular weight of 186.26 g/mol. Its IUPAC name is 2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate.
Molecular Properties
| Compound Name | 2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate |
| PubChem CID | 66972788 |
| Molecular Formula | C8H12NO2S- |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.06 |
| IUPAC Name | 2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate |
| SMILES | Cc1ccn(C)c1CCS(=O)[O-] |
| InChI | InChI=1S/C8H13NO2S/c1-7-3-5-9(2)8(7)4-6-12(10)11/h3,5H,4,6H2,1-2H3,(H,10,11)/p-1 |
| InChIKey | WADNDKXSJUQIDS-UHFFFAOYSA-M |
| XLogP | 0.76 |
| TPSA | 45.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate?
The IUPAC name of 2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate (CID 66972788) is 2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate.
What is the SMILES notation for 2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate?
The canonical SMILES for 2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate is Cc1ccn(C)c1CCS(=O)[O-].
What is the InChIKey of 2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate?
The InChIKey is WADNDKXSJUQIDS-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H13NO2S/c1-7-3-5-9(2)8(7)4-6-12(10)11/h3,5H,4,6H2,1-2H3,(H,10,11)/p-1.
What are the key properties of 2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate?
2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate has a molecular weight of 186.26 g/mol, XLogP of 0.76, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethylpyrrol-2-yl)ethanesulfinate is sourced from PubChem (CID 66972788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).