C17H19F2NO4 — CID 66973038
2-[(6S)-6-(3,5-difluorophenyl)-3,3-dimethyl-2,4-dioxopiperidin-1-yl]butanoic acid (PubChem CID 66973038) has the molecular formula C17H19F2NO4 and a molecular weight of 339.34 g/mol. Its IUPAC name is 2-[(6S)-6-(3,5-difluorophenyl)-3,3-dimethyl-2,4-dioxopiperidin-1-yl]butanoic acid.
| Compound Name | 2-[(6S)-6-(3,5-difluorophenyl)-3,3-dimethyl-2,4-dioxopiperidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 66973038 |
| Molecular Formula | C17H19F2NO4 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-[(6S)-6-(3,5-difluorophenyl)-3,3-dimethyl-2,4-dioxopiperidin-1-yl]butanoic acid |
| SMILES | CCC(C(=O)O)N1C(=O)C(C)(C)C(=O)C[C@H]1c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C17H19F2NO4/c1-4-12(15(22)23)20-13(8-14(21)17(2,3)16(20)24)9-5-10(18)7-11(19)6-9/h5-7,12-13H,4,8H2,1-3H3,(H,22,23)/t12?,13-/m0/s1 |
| InChIKey | JMZWJCMDZWGICR-ABLWVSNPSA-N |
| XLogP | 2.70 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|