C14H20O2 — CID 66973345
1,1-diethoxybut-1-en-2-ylbenzene (PubChem CID 66973345) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is 1,1-diethoxybut-1-en-2-ylbenzene.
| Compound Name | 1,1-diethoxybut-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 66973345 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 1,1-diethoxybut-1-en-2-ylbenzene |
| SMILES | CCOC(OCC)=C(CC)c1ccccc1 |
| InChI | InChI=1S/C14H20O2/c1-4-13(12-10-8-7-9-11-12)14(15-5-2)16-6-3/h7-11H,4-6H2,1-3H3 |
| InChIKey | CPBUXQGIODZAMT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|