C19H14F3NO2 — CID 66973657
2-(3-benzyl-4,4,4-trifluorobut-2-enyl)isoindole-1,3-dione (PubChem CID 66973657) has the molecular formula C19H14F3NO2 and a molecular weight of 345.32 g/mol. Its IUPAC name is 2-(3-benzyl-4,4,4-trifluorobut-2-enyl)isoindole-1,3-dione.
| Compound Name | 2-(3-benzyl-4,4,4-trifluorobut-2-enyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 66973657 |
| Molecular Formula | C19H14F3NO2 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 2-(3-benzyl-4,4,4-trifluorobut-2-enyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CC=C(Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H14F3NO2/c20-19(21,22)14(12-13-6-2-1-3-7-13)10-11-23-17(24)15-8-4-5-9-16(15)18(23)25/h1-10H,11-12H2 |
| InChIKey | CMKAITRDOFCHLI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|