C23H26N6OS — CID 66973694
2-amino-N-[3-[2-(4-methylpiperazin-1-yl)-4-phenylpyrimidin-5-yl]sulfanylphenyl]acetamide (PubChem CID 66973694) has the molecular formula C23H26N6OS and a molecular weight of 434.57 g/mol. Its IUPAC name is 2-amino-N-[3-[2-(4-methylpiperazin-1-yl)-4-phenylpyrimidin-5-yl]sulfanylphenyl]acetamide.
| Compound Name | 2-amino-N-[3-[2-(4-methylpiperazin-1-yl)-4-phenylpyrimidin-5-yl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 66973694 |
| Molecular Formula | C23H26N6OS |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 2-amino-N-[3-[2-(4-methylpiperazin-1-yl)-4-phenylpyrimidin-5-yl]sulfanylphenyl]acetamide |
| SMILES | CN1CCN(c2ncc(Sc3cccc(NC(=O)CN)c3)c(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C23H26N6OS/c1-28-10-12-29(13-11-28)23-25-16-20(22(27-23)17-6-3-2-4-7-17)31-19-9-5-8-18(14-19)26-21(30)15-24/h2-9,14,16H,10-13,15,24H2,1H3,(H,26,30) |
| InChIKey | PRPJPXKHEXEWMD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |