About CID 66974147
CID 66974147 (PubChem CID 66974147) has the molecular formula C14H6BF2N2O2
and a molecular weight of 283.02 g/mol.
Molecular Properties
| Compound Name | CID 66974147 |
| PubChem CID | 66974147 |
| Molecular Formula | C14H6BF2N2O2 |
| Molecular Weight | 283.02 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | — |
| SMILES | N#Cc1ccc(O[B]Oc2ccc(C#N)c(F)c2)cc1F |
| InChI | InChI=1S/C14H6BF2N2O2/c16-13-5-11(3-1-9(13)7-18)20-15-21-12-4-2-10(8-19)14(17)6-12/h1-6H |
| InChIKey | WJSZTKCRKZAYLO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.02 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 66974147 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 66974147?
The IUPAC name of CID 66974147 (CID 66974147) is not available.
What is the SMILES notation for CID 66974147?
The canonical SMILES for CID 66974147 is N#Cc1ccc(O[B]Oc2ccc(C#N)c(F)c2)cc1F.
What is the InChIKey of CID 66974147?
The InChIKey is WJSZTKCRKZAYLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6BF2N2O2/c16-13-5-11(3-1-9(13)7-18)20-15-21-12-4-2-10(8-19)14(17)6-12/h1-6H.
What are the key properties of CID 66974147?
CID 66974147 has a molecular weight of 283.02 g/mol, XLogP of 2.70, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 66974147 is sourced from PubChem (CID 66974147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).