About 2-(1,3-thiazol-2-yl)-1,3-thiazol-4-one
2-(1,3-thiazol-2-yl)-1,3-thiazol-4-one (PubChem CID 66974641) has the molecular formula C6H4N2OS2
and a molecular weight of 184.25 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-yl)-1,3-thiazol-4-one.
Molecular Properties
| Compound Name | 2-(1,3-thiazol-2-yl)-1,3-thiazol-4-one |
| PubChem CID | 66974641 |
| Molecular Formula | C6H4N2OS2 |
| Molecular Weight | 184.25 g/mol |
| Exact Mass | 183.98 |
| IUPAC Name | 2-(1,3-thiazol-2-yl)-1,3-thiazol-4-one |
| SMILES | O=C1CSC(c2nccs2)=N1 |
| InChI | InChI=1S/C6H4N2OS2/c9-4-3-11-6(8-4)5-7-1-2-10-5/h1-2H,3H2 |
| InChIKey | XQHISZUUSXDYBT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,3-thiazol-2-yl)-1,3-thiazol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-thiazol-2-yl)-1,3-thiazol-4-one?
The IUPAC name of 2-(1,3-thiazol-2-yl)-1,3-thiazol-4-one (CID 66974641) is 2-(1,3-thiazol-2-yl)-1,3-thiazol-4-one.
What is the SMILES notation for 2-(1,3-thiazol-2-yl)-1,3-thiazol-4-one?
The canonical SMILES for 2-(1,3-thiazol-2-yl)-1,3-thiazol-4-one is O=C1CSC(c2nccs2)=N1.
What is the InChIKey of 2-(1,3-thiazol-2-yl)-1,3-thiazol-4-one?
The InChIKey is XQHISZUUSXDYBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N2OS2/c9-4-3-11-6(8-4)5-7-1-2-10-5/h1-2H,3H2.
What are the key properties of 2-(1,3-thiazol-2-yl)-1,3-thiazol-4-one?
2-(1,3-thiazol-2-yl)-1,3-thiazol-4-one has a molecular weight of 184.25 g/mol, XLogP of 1.16, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-2-yl)-1,3-thiazol-4-one is sourced from PubChem (CID 66974641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).