C16H11F3N4O5 — CID 66974735
ethyl 5-(2-nitrophenyl)-7-oxo-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-3-carboxylate (PubChem CID 66974735) has the molecular formula C16H11F3N4O5 and a molecular weight of 396.28 g/mol. Its IUPAC name is ethyl 5-(2-nitrophenyl)-7-oxo-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl 5-(2-nitrophenyl)-7-oxo-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 66974735 |
| Molecular Formula | C16H11F3N4O5 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | ethyl 5-(2-nitrophenyl)-7-oxo-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C(F)(F)F)[nH]n2c(=O)cc(-c3ccccc3[N+](=O)[O-])nc12 |
| InChI | InChI=1S/C16H11F3N4O5/c1-2-28-15(25)12-13(16(17,18)19)21-22-11(24)7-9(20-14(12)22)8-5-3-4-6-10(8)23(26)27/h3-7,21H,2H2,1H3 |
| InChIKey | UTLFGGIVFBPDMS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|