About 5-tert-butyl-3-thiophen-2-yl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one
5-tert-butyl-3-thiophen-2-yl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (PubChem CID 66974913) has the molecular formula C15H14F3N3OS
and a molecular weight of 341.36 g/mol. Its IUPAC name is 5-tert-butyl-3-thiophen-2-yl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5-tert-butyl-3-thiophen-2-yl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| PubChem CID | 66974913 |
| Molecular Formula | C15H14F3N3OS |
| Molecular Weight | 341.36 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | 5-tert-butyl-3-thiophen-2-yl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one |
| SMILES | CC(C)(C)c1cc(=O)n2[nH]c(C(F)(F)F)c(-c3cccs3)c2n1 |
| InChI | InChI=1S/C15H14F3N3OS/c1-14(2,3)9-7-10(22)21-13(19-9)11(8-5-4-6-23-8)12(20-21)15(16,17)18/h4-7,20H,1-3H3 |
| InChIKey | JZMRTLAVUIJPNZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-tert-butyl-3-thiophen-2-yl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-3-thiophen-2-yl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The IUPAC name of 5-tert-butyl-3-thiophen-2-yl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one (CID 66974913) is 5-tert-butyl-3-thiophen-2-yl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one.
What is the SMILES notation for 5-tert-butyl-3-thiophen-2-yl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The canonical SMILES for 5-tert-butyl-3-thiophen-2-yl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one is CC(C)(C)c1cc(=O)n2[nH]c(C(F)(F)F)c(-c3cccs3)c2n1.
What is the InChIKey of 5-tert-butyl-3-thiophen-2-yl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
The InChIKey is JZMRTLAVUIJPNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14F3N3OS/c1-14(2,3)9-7-10(22)21-13(19-9)11(8-5-4-6-23-8)12(20-21)15(16,17)18/h4-7,20H,1-3H3.
What are the key properties of 5-tert-butyl-3-thiophen-2-yl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one?
5-tert-butyl-3-thiophen-2-yl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one has a molecular weight of 341.36 g/mol, XLogP of 4.07, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-3-thiophen-2-yl-2-(trifluoromethyl)-1H-pyrazolo[1,5-a]pyrimidin-7-one is sourced from PubChem (CID 66974913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).