C18H23Cl2NO3 — CID 66974991
tert-butyl (6R,7S)-6-(3,4-dichlorophenyl)-7-ethenyl-1,4-oxazepane-4-carboxylate (PubChem CID 66974991) has the molecular formula C18H23Cl2NO3 and a molecular weight of 372.29 g/mol. Its IUPAC name is tert-butyl (6R,7S)-6-(3,4-dichlorophenyl)-7-ethenyl-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl (6R,7S)-6-(3,4-dichlorophenyl)-7-ethenyl-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 66974991 |
| Molecular Formula | C18H23Cl2NO3 |
| Molecular Weight | 372.29 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | tert-butyl (6R,7S)-6-(3,4-dichlorophenyl)-7-ethenyl-1,4-oxazepane-4-carboxylate |
| SMILES | C=C[C@@H]1OCCN(C(=O)OC(C)(C)C)C[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H23Cl2NO3/c1-5-16-13(12-6-7-14(19)15(20)10-12)11-21(8-9-23-16)17(22)24-18(2,3)4/h5-7,10,13,16H,1,8-9,11H2,2-4H3/t13-,16-/m0/s1 |
| InChIKey | XHHWBGIMRXAYSV-BBRMVZONSA-N |
| XLogP | 4.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.29 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|