C19H25Cl2FN2O4 — CID 66975195
tert-butyl (6R,7R)-6-[[(2-chloroacetyl)amino]methyl]-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylate (PubChem CID 66975195) has the molecular formula C19H25Cl2FN2O4 and a molecular weight of 435.32 g/mol. Its IUPAC name is tert-butyl (6R,7R)-6-[[(2-chloroacetyl)amino]methyl]-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl (6R,7R)-6-[[(2-chloroacetyl)amino]methyl]-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 66975195 |
| Molecular Formula | C19H25Cl2FN2O4 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.12 |
| IUPAC Name | tert-butyl (6R,7R)-6-[[(2-chloroacetyl)amino]methyl]-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@@H](c2ccc(Cl)c(F)c2)[C@H](CNC(=O)CCl)C1 |
| InChI | InChI=1S/C19H25Cl2FN2O4/c1-19(2,3)28-18(26)24-6-7-27-17(12-4-5-14(21)15(22)8-12)13(11-24)10-23-16(25)9-20/h4-5,8,13,17H,6-7,9-11H2,1-3H3,(H,23,25)/t13-,17+/m1/s1 |
| InChIKey | DHDYGOHKGKDEPG-DYVFJYSZSA-N |
| XLogP | 3.76 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|