About 6-(3,4-dichlorophenyl)-1,4-oxazepan-6-ol;hydrochloride
6-(3,4-dichlorophenyl)-1,4-oxazepan-6-ol;hydrochloride (PubChem CID 66975325) has the molecular formula C11H14Cl3NO2
and a molecular weight of 298.60 g/mol. Its IUPAC name is 6-(3,4-dichlorophenyl)-1,4-oxazepan-6-ol;hydrochloride.
Molecular Properties
| Compound Name | 6-(3,4-dichlorophenyl)-1,4-oxazepan-6-ol;hydrochloride |
| PubChem CID | 66975325 |
| Molecular Formula | C11H14Cl3NO2 |
| Molecular Weight | 298.60 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 6-(3,4-dichlorophenyl)-1,4-oxazepan-6-ol;hydrochloride |
| SMILES | Cl.OC1(c2ccc(Cl)c(Cl)c2)CNCCOC1 |
| InChI | InChI=1S/C11H13Cl2NO2.ClH/c12-9-2-1-8(5-10(9)13)11(15)6-14-3-4-16-7-11;/h1-2,5,14-15H,3-4,6-7H2;1H |
| InChIKey | XQUIKTJNTFGEBU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.60 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(3,4-dichlorophenyl)-1,4-oxazepan-6-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4-dichlorophenyl)-1,4-oxazepan-6-ol;hydrochloride?
The IUPAC name of 6-(3,4-dichlorophenyl)-1,4-oxazepan-6-ol;hydrochloride (CID 66975325) is 6-(3,4-dichlorophenyl)-1,4-oxazepan-6-ol;hydrochloride.
What is the SMILES notation for 6-(3,4-dichlorophenyl)-1,4-oxazepan-6-ol;hydrochloride?
The canonical SMILES for 6-(3,4-dichlorophenyl)-1,4-oxazepan-6-ol;hydrochloride is Cl.OC1(c2ccc(Cl)c(Cl)c2)CNCCOC1.
What is the InChIKey of 6-(3,4-dichlorophenyl)-1,4-oxazepan-6-ol;hydrochloride?
The InChIKey is XQUIKTJNTFGEBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl2NO2.ClH/c12-9-2-1-8(5-10(9)13)11(15)6-14-3-4-16-7-11;/h1-2,5,14-15H,3-4,6-7H2;1H.
What are the key properties of 6-(3,4-dichlorophenyl)-1,4-oxazepan-6-ol;hydrochloride?
6-(3,4-dichlorophenyl)-1,4-oxazepan-6-ol;hydrochloride has a molecular weight of 298.60 g/mol, XLogP of 2.22, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4-dichlorophenyl)-1,4-oxazepan-6-ol;hydrochloride is sourced from PubChem (CID 66975325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).