C13H17ClFN3O2 — CID 66975331
[(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methylurea (PubChem CID 66975331) has the molecular formula C13H17ClFN3O2 and a molecular weight of 301.75 g/mol. Its IUPAC name is [(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methylurea.
| Compound Name | [(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methylurea |
|---|---|
| PubChem CID | 66975331 |
| Molecular Formula | C13H17ClFN3O2 |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | [(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methylurea |
| SMILES | NC(=O)NC[C@H]1CNCCO[C@@H]1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClFN3O2/c14-10-5-8(1-2-11(10)15)12-9(7-18-13(16)19)6-17-3-4-20-12/h1-2,5,9,12,17H,3-4,6-7H2,(H3,16,18,19)/t9-,12-/m1/s1 |
| InChIKey | BLHJFDFNPDRBCU-BXKDBHETSA-N |
| XLogP | 1.42 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |