C12H17ClFN3O3S — CID 66975337
(6R,7S)-7-(3-chloro-4-fluorophenyl)-6-[(sulfamoylamino)methyl]-1,4-oxazepane (PubChem CID 66975337) has the molecular formula C12H17ClFN3O3S and a molecular weight of 337.80 g/mol. Its IUPAC name is (6R,7S)-7-(3-chloro-4-fluorophenyl)-6-[(sulfamoylamino)methyl]-1,4-oxazepane.
| Compound Name | (6R,7S)-7-(3-chloro-4-fluorophenyl)-6-[(sulfamoylamino)methyl]-1,4-oxazepane |
|---|---|
| PubChem CID | 66975337 |
| Molecular Formula | C12H17ClFN3O3S |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | (6R,7S)-7-(3-chloro-4-fluorophenyl)-6-[(sulfamoylamino)methyl]-1,4-oxazepane |
| SMILES | NS(=O)(=O)NC[C@H]1CNCCO[C@@H]1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H17ClFN3O3S/c13-10-5-8(1-2-11(10)14)12-9(6-16-3-4-20-12)7-17-21(15,18)19/h1-2,5,9,12,16-17H,3-4,6-7H2,(H2,15,18,19)/t9-,12-/m1/s1 |
| InChIKey | TWDRKPQJHGVNRS-BXKDBHETSA-N |
| XLogP | 0.55 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |