C22H24Cl3NO3 — CID 66975431
N-benzyl-2-chloro-N-[2-(3,4-dichlorophenyl)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide (PubChem CID 66975431) has the molecular formula C22H24Cl3NO3 and a molecular weight of 456.80 g/mol. Its IUPAC name is N-benzyl-2-chloro-N-[2-(3,4-dichlorophenyl)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide.
| Compound Name | N-benzyl-2-chloro-N-[2-(3,4-dichlorophenyl)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 66975431 |
| Molecular Formula | C22H24Cl3NO3 |
| Molecular Weight | 456.80 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | N-benzyl-2-chloro-N-[2-(3,4-dichlorophenyl)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethyl]acetamide |
| SMILES | CC1(C)OCC(C(CN(Cc2ccccc2)C(=O)CCl)c2ccc(Cl)c(Cl)c2)O1 |
| InChI | InChI=1S/C22H24Cl3NO3/c1-22(2)28-14-20(29-22)17(16-8-9-18(24)19(25)10-16)13-26(21(27)11-23)12-15-6-4-3-5-7-15/h3-10,17,20H,11-14H2,1-2H3 |
| InChIKey | GZVKRGZRJGJINV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.80 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|