About (7S)-7-(aminomethyl)-2-tert-butyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylic acid
(7S)-7-(aminomethyl)-2-tert-butyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylic acid (PubChem CID 66975440) has the molecular formula C17H24ClFN2O3
and a molecular weight of 358.84 g/mol. Its IUPAC name is (7S)-7-(aminomethyl)-2-tert-butyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylic acid.
Molecular Properties
| Compound Name | (7S)-7-(aminomethyl)-2-tert-butyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylic acid |
| PubChem CID | 66975440 |
| Molecular Formula | C17H24ClFN2O3 |
| Molecular Weight | 358.84 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | (7S)-7-(aminomethyl)-2-tert-butyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylic acid |
| SMILES | CC(C)(C)C1CN(C(=O)O)CC[C@@](CN)(c2ccc(Cl)c(F)c2)O1 |
| InChI | InChI=1S/C17H24ClFN2O3/c1-16(2,3)14-9-21(15(22)23)7-6-17(10-20,24-14)11-4-5-12(18)13(19)8-11/h4-5,8,14H,6-7,9-10,20H2,1-3H3,(H,22,23)/t14?,17-/m1/s1 |
| InChIKey | JSCANZVOALXQFG-FBMWCMRBSA-N |
| XLogP | 3.45 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.84 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (7S)-7-(aminomethyl)-2-tert-butyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-7-(aminomethyl)-2-tert-butyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylic acid?
The IUPAC name of (7S)-7-(aminomethyl)-2-tert-butyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylic acid (CID 66975440) is (7S)-7-(aminomethyl)-2-tert-butyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylic acid.
What is the SMILES notation for (7S)-7-(aminomethyl)-2-tert-butyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylic acid?
The canonical SMILES for (7S)-7-(aminomethyl)-2-tert-butyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylic acid is CC(C)(C)C1CN(C(=O)O)CC[C@@](CN)(c2ccc(Cl)c(F)c2)O1.
What is the InChIKey of (7S)-7-(aminomethyl)-2-tert-butyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylic acid?
The InChIKey is JSCANZVOALXQFG-FBMWCMRBSA-N. The full InChI is InChI=1S/C17H24ClFN2O3/c1-16(2,3)14-9-21(15(22)23)7-6-17(10-20,24-14)11-4-5-12(18)13(19)8-11/h4-5,8,14H,6-7,9-10,20H2,1-3H3,(H,22,23)/t14?,17-/m1/s1.
What are the key properties of (7S)-7-(aminomethyl)-2-tert-butyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylic acid?
(7S)-7-(aminomethyl)-2-tert-butyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylic acid has a molecular weight of 358.84 g/mol, XLogP of 3.45, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-7-(aminomethyl)-2-tert-butyl-7-(4-chloro-3-fluorophenyl)-1,4-oxazepane-4-carboxylic acid is sourced from PubChem (CID 66975440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).