C18H22Cl2F3NO4 — CID 66975536
tert-butyl (6S,7R)-7-(3,4-dichlorophenyl)-6-(2,2,2-trifluoro-1-hydroxyethyl)-1,4-oxazepane-4-carboxylate (PubChem CID 66975536) has the molecular formula C18H22Cl2F3NO4 and a molecular weight of 444.28 g/mol. Its IUPAC name is tert-butyl (6S,7R)-7-(3,4-dichlorophenyl)-6-(2,2,2-trifluoro-1-hydroxyethyl)-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl (6S,7R)-7-(3,4-dichlorophenyl)-6-(2,2,2-trifluoro-1-hydroxyethyl)-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 66975536 |
| Molecular Formula | C18H22Cl2F3NO4 |
| Molecular Weight | 444.28 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | tert-butyl (6S,7R)-7-(3,4-dichlorophenyl)-6-(2,2,2-trifluoro-1-hydroxyethyl)-1,4-oxazepane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@@H](c2ccc(Cl)c(Cl)c2)[C@H](C(O)C(F)(F)F)C1 |
| InChI | InChI=1S/C18H22Cl2F3NO4/c1-17(2,3)28-16(26)24-6-7-27-14(10-4-5-12(19)13(20)8-10)11(9-24)15(25)18(21,22)23/h4-5,8,11,14-15,25H,6-7,9H2,1-3H3/t11-,14+,15?/m1/s1 |
| InChIKey | UDFMURRKRSOWRW-IFVPNFOKSA-N |
| XLogP | 4.84 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.28 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |