About [(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol
[(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol (PubChem CID 66975743) has the molecular formula C12H15ClFNO2
and a molecular weight of 259.71 g/mol. Its IUPAC name is [(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol.
Molecular Properties
| Compound Name | [(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol |
| PubChem CID | 66975743 |
| Molecular Formula | C12H15ClFNO2 |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | [(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol |
| SMILES | OC[C@H]1CNCCO[C@@H]1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClFNO2/c13-10-5-8(1-2-11(10)14)12-9(7-16)6-15-3-4-17-12/h1-2,5,9,12,15-16H,3-4,6-7H2/t9-,12-/m1/s1 |
| InChIKey | KMRWOXQDKILGNS-BXKDBHETSA-N |
| XLogP | 1.75 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol?
The IUPAC name of [(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol (CID 66975743) is [(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol.
What is the SMILES notation for [(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol?
The canonical SMILES for [(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol is OC[C@H]1CNCCO[C@@H]1c1ccc(F)c(Cl)c1.
What is the InChIKey of [(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol?
The InChIKey is KMRWOXQDKILGNS-BXKDBHETSA-N. The full InChI is InChI=1S/C12H15ClFNO2/c13-10-5-8(1-2-11(10)14)12-9(7-16)6-15-3-4-17-12/h1-2,5,9,12,15-16H,3-4,6-7H2/t9-,12-/m1/s1.
What are the key properties of [(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol?
[(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol has a molecular weight of 259.71 g/mol, XLogP of 1.75, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(6R,7S)-7-(3-chloro-4-fluorophenyl)-1,4-oxazepan-6-yl]methanol is sourced from PubChem (CID 66975743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).