C20H21Cl2NO4 — CID 66975776
methyl 2-[[(6R,7R)-6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methoxy]benzoate (PubChem CID 66975776) has the molecular formula C20H21Cl2NO4 and a molecular weight of 410.30 g/mol. Its IUPAC name is methyl 2-[[(6R,7R)-6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methoxy]benzoate.
| Compound Name | methyl 2-[[(6R,7R)-6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 66975776 |
| Molecular Formula | C20H21Cl2NO4 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | methyl 2-[[(6R,7R)-6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methoxy]benzoate |
| SMILES | COC(=O)c1ccccc1OC[C@@H]1OCCNC[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H21Cl2NO4/c1-25-20(24)14-4-2-3-5-18(14)27-12-19-15(11-23-8-9-26-19)13-6-7-16(21)17(22)10-13/h2-7,10,15,19,23H,8-9,11-12H2,1H3/t15-,19-/m0/s1 |
| InChIKey | QXKFOLCOPNIKJN-KXBFYZLASA-N |
| XLogP | 3.93 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |