C15H21Cl2FN2O3 — CID 66975964
(6R,7R)-7-(4-chloro-3-fluorophenyl)-N-(2-methoxyethyl)-1,4-oxazepane-6-carboxamide;hydrochloride (PubChem CID 66975964) has the molecular formula C15H21Cl2FN2O3 and a molecular weight of 367.25 g/mol. Its IUPAC name is (6R,7R)-7-(4-chloro-3-fluorophenyl)-N-(2-methoxyethyl)-1,4-oxazepane-6-carboxamide;hydrochloride.
| Compound Name | (6R,7R)-7-(4-chloro-3-fluorophenyl)-N-(2-methoxyethyl)-1,4-oxazepane-6-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 66975964 |
| Molecular Formula | C15H21Cl2FN2O3 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (6R,7R)-7-(4-chloro-3-fluorophenyl)-N-(2-methoxyethyl)-1,4-oxazepane-6-carboxamide;hydrochloride |
| SMILES | COCCNC(=O)[C@@H]1CNCCO[C@H]1c1ccc(Cl)c(F)c1.Cl |
| InChI | InChI=1S/C15H20ClFN2O3.ClH/c1-21-6-5-19-15(20)11-9-18-4-7-22-14(11)10-2-3-12(16)13(17)8-10;/h2-3,8,11,14,18H,4-7,9H2,1H3,(H,19,20);1H/t11-,14+;/m1./s1 |
| InChIKey | KTQFHYRXRQXHKH-GGMFNZDASA-N |
| XLogP | 1.94 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|