C14H16Cl2N2O3 — CID 66976001
N-[(6R,7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]-2-oxopropanamide (PubChem CID 66976001) has the molecular formula C14H16Cl2N2O3 and a molecular weight of 331.20 g/mol. Its IUPAC name is N-[(6R,7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]-2-oxopropanamide.
| Compound Name | N-[(6R,7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]-2-oxopropanamide |
|---|---|
| PubChem CID | 66976001 |
| Molecular Formula | C14H16Cl2N2O3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | N-[(6R,7S)-7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]-2-oxopropanamide |
| SMILES | CC(=O)C(=O)N[C@@H]1CNCCO[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H16Cl2N2O3/c1-8(19)14(20)18-12-7-17-4-5-21-13(12)9-2-3-10(15)11(16)6-9/h2-3,6,12-13,17H,4-5,7H2,1H3,(H,18,20)/t12-,13+/m1/s1 |
| InChIKey | QUZJJEBBXBIXMO-OLZOCXBDSA-N |
| XLogP | 1.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|