About 6-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]oxy]pyridine-2-carbonitrile;hydrochloride
6-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]oxy]pyridine-2-carbonitrile;hydrochloride (PubChem CID 66976102) has the molecular formula C17H16Cl3N3O2
and a molecular weight of 400.69 g/mol. Its IUPAC name is 6-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]oxy]pyridine-2-carbonitrile;hydrochloride.
Molecular Properties
| Compound Name | 6-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]oxy]pyridine-2-carbonitrile;hydrochloride |
| PubChem CID | 66976102 |
| Molecular Formula | C17H16Cl3N3O2 |
| Molecular Weight | 400.69 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | 6-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]oxy]pyridine-2-carbonitrile;hydrochloride |
| SMILES | Cl.N#Cc1cccc(OC2CNCCOC2c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C17H15Cl2N3O2.ClH/c18-13-5-4-11(8-14(13)19)17-15(10-21-6-7-23-17)24-16-3-1-2-12(9-20)22-16;/h1-5,8,15,17,21H,6-7,10H2;1H |
| InChIKey | YSFWQDULVAKJIC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.69 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]oxy]pyridine-2-carbonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]oxy]pyridine-2-carbonitrile;hydrochloride?
The IUPAC name of 6-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]oxy]pyridine-2-carbonitrile;hydrochloride (CID 66976102) is 6-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]oxy]pyridine-2-carbonitrile;hydrochloride.
What is the SMILES notation for 6-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]oxy]pyridine-2-carbonitrile;hydrochloride?
The canonical SMILES for 6-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]oxy]pyridine-2-carbonitrile;hydrochloride is Cl.N#Cc1cccc(OC2CNCCOC2c2ccc(Cl)c(Cl)c2)n1.
What is the InChIKey of 6-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]oxy]pyridine-2-carbonitrile;hydrochloride?
The InChIKey is YSFWQDULVAKJIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15Cl2N3O2.ClH/c18-13-5-4-11(8-14(13)19)17-15(10-21-6-7-23-17)24-16-3-1-2-12(9-20)22-16;/h1-5,8,15,17,21H,6-7,10H2;1H.
What are the key properties of 6-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]oxy]pyridine-2-carbonitrile;hydrochloride?
6-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]oxy]pyridine-2-carbonitrile;hydrochloride has a molecular weight of 400.69 g/mol, XLogP of 3.79, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[7-(3,4-dichlorophenyl)-1,4-oxazepan-6-yl]oxy]pyridine-2-carbonitrile;hydrochloride is sourced from PubChem (CID 66976102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).