C22H29Cl2NO6 — CID 66976293
(6R,7R)-2-tert-butyl-7-(3,4-dichlorophenyl)-6-(4-ethoxy-2,4-dioxobutyl)-1,4-oxazepane-4-carboxylic acid (PubChem CID 66976293) has the molecular formula C22H29Cl2NO6 and a molecular weight of 474.38 g/mol. Its IUPAC name is (6R,7R)-2-tert-butyl-7-(3,4-dichlorophenyl)-6-(4-ethoxy-2,4-dioxobutyl)-1,4-oxazepane-4-carboxylic acid.
| Compound Name | (6R,7R)-2-tert-butyl-7-(3,4-dichlorophenyl)-6-(4-ethoxy-2,4-dioxobutyl)-1,4-oxazepane-4-carboxylic acid |
|---|---|
| PubChem CID | 66976293 |
| Molecular Formula | C22H29Cl2NO6 |
| Molecular Weight | 474.38 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | (6R,7R)-2-tert-butyl-7-(3,4-dichlorophenyl)-6-(4-ethoxy-2,4-dioxobutyl)-1,4-oxazepane-4-carboxylic acid |
| SMILES | CCOC(=O)CC(=O)C[C@@H]1CN(C(=O)O)CC(C(C)(C)C)O[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H29Cl2NO6/c1-5-30-19(27)10-15(26)8-14-11-25(21(28)29)12-18(22(2,3)4)31-20(14)13-6-7-16(23)17(24)9-13/h6-7,9,14,18,20H,5,8,10-12H2,1-4H3,(H,28,29)/t14-,18?,20+/m1/s1 |
| InChIKey | WDQASNFDPQSVSG-IJQBRSJXSA-N |
| XLogP | 4.99 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|