About 7-(3,4-dichlorophenyl)-7-[(4-methoxyphenoxy)methyl]-1,4-oxazepane
7-(3,4-dichlorophenyl)-7-[(4-methoxyphenoxy)methyl]-1,4-oxazepane (PubChem CID 66976504) has the molecular formula C19H21Cl2NO3
and a molecular weight of 382.29 g/mol. Its IUPAC name is 7-(3,4-dichlorophenyl)-7-[(4-methoxyphenoxy)methyl]-1,4-oxazepane.
Molecular Properties
| Compound Name | 7-(3,4-dichlorophenyl)-7-[(4-methoxyphenoxy)methyl]-1,4-oxazepane |
| PubChem CID | 66976504 |
| Molecular Formula | C19H21Cl2NO3 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 7-(3,4-dichlorophenyl)-7-[(4-methoxyphenoxy)methyl]-1,4-oxazepane |
| SMILES | COc1ccc(OCC2(c3ccc(Cl)c(Cl)c3)CCNCCO2)cc1 |
| InChI | InChI=1S/C19H21Cl2NO3/c1-23-15-3-5-16(6-4-15)24-13-19(8-9-22-10-11-25-19)14-2-7-17(20)18(21)12-14/h2-7,12,22H,8-11,13H2,1H3 |
| InChIKey | FPVPPMDUXUWPLB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-(3,4-dichlorophenyl)-7-[(4-methoxyphenoxy)methyl]-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(3,4-dichlorophenyl)-7-[(4-methoxyphenoxy)methyl]-1,4-oxazepane?
The IUPAC name of 7-(3,4-dichlorophenyl)-7-[(4-methoxyphenoxy)methyl]-1,4-oxazepane (CID 66976504) is 7-(3,4-dichlorophenyl)-7-[(4-methoxyphenoxy)methyl]-1,4-oxazepane.
What is the SMILES notation for 7-(3,4-dichlorophenyl)-7-[(4-methoxyphenoxy)methyl]-1,4-oxazepane?
The canonical SMILES for 7-(3,4-dichlorophenyl)-7-[(4-methoxyphenoxy)methyl]-1,4-oxazepane is COc1ccc(OCC2(c3ccc(Cl)c(Cl)c3)CCNCCO2)cc1.
What is the InChIKey of 7-(3,4-dichlorophenyl)-7-[(4-methoxyphenoxy)methyl]-1,4-oxazepane?
The InChIKey is FPVPPMDUXUWPLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21Cl2NO3/c1-23-15-3-5-16(6-4-15)24-13-19(8-9-22-10-11-25-19)14-2-7-17(20)18(21)12-14/h2-7,12,22H,8-11,13H2,1H3.
What are the key properties of 7-(3,4-dichlorophenyl)-7-[(4-methoxyphenoxy)methyl]-1,4-oxazepane?
7-(3,4-dichlorophenyl)-7-[(4-methoxyphenoxy)methyl]-1,4-oxazepane has a molecular weight of 382.29 g/mol, XLogP of 4.29, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(3,4-dichlorophenyl)-7-[(4-methoxyphenoxy)methyl]-1,4-oxazepane is sourced from PubChem (CID 66976504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).