C17H22Cl2INO3 — CID 66976721
tert-butyl (6R,7S)-6-(3,4-dichlorophenyl)-7-(iodomethyl)-1,4-oxazepane-4-carboxylate (PubChem CID 66976721) has the molecular formula C17H22Cl2INO3 and a molecular weight of 486.18 g/mol. Its IUPAC name is tert-butyl (6R,7S)-6-(3,4-dichlorophenyl)-7-(iodomethyl)-1,4-oxazepane-4-carboxylate.
| Compound Name | tert-butyl (6R,7S)-6-(3,4-dichlorophenyl)-7-(iodomethyl)-1,4-oxazepane-4-carboxylate |
|---|---|
| PubChem CID | 66976721 |
| Molecular Formula | C17H22Cl2INO3 |
| Molecular Weight | 486.18 g/mol |
| Exact Mass | 485.00 |
| IUPAC Name | tert-butyl (6R,7S)-6-(3,4-dichlorophenyl)-7-(iodomethyl)-1,4-oxazepane-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@H](CI)[C@H](c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C17H22Cl2INO3/c1-17(2,3)24-16(22)21-6-7-23-15(9-20)12(10-21)11-4-5-13(18)14(19)8-11/h4-5,8,12,15H,6-7,9-10H2,1-3H3/t12-,15+/m0/s1 |
| InChIKey | GMTKHMHRRSKTFM-SWLSCSKDSA-N |
| XLogP | 5.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.18 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|