C12H15Cl2NO2 — CID 66976754
[(6R,7S)-6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol (PubChem CID 66976754) has the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. Its IUPAC name is [(6R,7S)-6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol.
| Compound Name | [(6R,7S)-6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol |
|---|---|
| PubChem CID | 66976754 |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.16 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | [(6R,7S)-6-(3,4-dichlorophenyl)-1,4-oxazepan-7-yl]methanol |
| SMILES | OC[C@H]1OCCNC[C@H]1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NO2/c13-10-2-1-8(5-11(10)14)9-6-15-3-4-17-12(9)7-16/h1-2,5,9,12,15-16H,3-4,6-7H2/t9-,12+/m0/s1 |
| InChIKey | ZWPJMVNJLBSRBR-JOYOIKCWSA-N |
| XLogP | 2.06 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |