About 7-(2,4-difluorophenoxy)-2,2-dimethylheptan-3-one
7-(2,4-difluorophenoxy)-2,2-dimethylheptan-3-one (PubChem CID 66977002) has the molecular formula C15H20F2O2
and a molecular weight of 270.32 g/mol. Its IUPAC name is 7-(2,4-difluorophenoxy)-2,2-dimethylheptan-3-one.
Molecular Properties
| Compound Name | 7-(2,4-difluorophenoxy)-2,2-dimethylheptan-3-one |
| PubChem CID | 66977002 |
| Molecular Formula | C15H20F2O2 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 7-(2,4-difluorophenoxy)-2,2-dimethylheptan-3-one |
| SMILES | CC(C)(C)C(=O)CCCCOc1ccc(F)cc1F |
| InChI | InChI=1S/C15H20F2O2/c1-15(2,3)14(18)6-4-5-9-19-13-8-7-11(16)10-12(13)17/h7-8,10H,4-6,9H2,1-3H3 |
| InChIKey | OKMBZQNRJOXTLV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-(2,4-difluorophenoxy)-2,2-dimethylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2,4-difluorophenoxy)-2,2-dimethylheptan-3-one?
The IUPAC name of 7-(2,4-difluorophenoxy)-2,2-dimethylheptan-3-one (CID 66977002) is 7-(2,4-difluorophenoxy)-2,2-dimethylheptan-3-one.
What is the SMILES notation for 7-(2,4-difluorophenoxy)-2,2-dimethylheptan-3-one?
The canonical SMILES for 7-(2,4-difluorophenoxy)-2,2-dimethylheptan-3-one is CC(C)(C)C(=O)CCCCOc1ccc(F)cc1F.
What is the InChIKey of 7-(2,4-difluorophenoxy)-2,2-dimethylheptan-3-one?
The InChIKey is OKMBZQNRJOXTLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F2O2/c1-15(2,3)14(18)6-4-5-9-19-13-8-7-11(16)10-12(13)17/h7-8,10H,4-6,9H2,1-3H3.
What are the key properties of 7-(2,4-difluorophenoxy)-2,2-dimethylheptan-3-one?
7-(2,4-difluorophenoxy)-2,2-dimethylheptan-3-one has a molecular weight of 270.32 g/mol, XLogP of 4.13, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2,4-difluorophenoxy)-2,2-dimethylheptan-3-one is sourced from PubChem (CID 66977002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).