C13H18BrN3O2S — CID 66977197
ethyl 1-(5-bromopyrimidin-2-yl)-4-methylsulfanylpiperidine-4-carboxylate (PubChem CID 66977197) has the molecular formula C13H18BrN3O2S and a molecular weight of 360.28 g/mol. Its IUPAC name is ethyl 1-(5-bromopyrimidin-2-yl)-4-methylsulfanylpiperidine-4-carboxylate.
| Compound Name | ethyl 1-(5-bromopyrimidin-2-yl)-4-methylsulfanylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 66977197 |
| Molecular Formula | C13H18BrN3O2S |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | ethyl 1-(5-bromopyrimidin-2-yl)-4-methylsulfanylpiperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(SC)CCN(c2ncc(Br)cn2)CC1 |
| InChI | InChI=1S/C13H18BrN3O2S/c1-3-19-11(18)13(20-2)4-6-17(7-5-13)12-15-8-10(14)9-16-12/h8-9H,3-7H2,1-2H3 |
| InChIKey | NVLUIAAXEYPJKZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |